C23H27N5O2S — CID 55828974
12-[[4-[2-(4-methoxyphenyl)ethyl]piperidin-1-yl]methyl]-8-methyl-5-thia-1,8,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,9,11-tetraen-7-one (PubChem CID 55828974) has the molecular formula C23H27N5O2S and a molecular weight of 437.57 g/mol. Its IUPAC name is 12-[[4-[2-(4-methoxyphenyl)ethyl]piperidin-1-yl]methyl]-8-methyl-5-thia-1,8,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,9,11-tetraen-7-one.
| Compound Name | 12-[[4-[2-(4-methoxyphenyl)ethyl]piperidin-1-yl]methyl]-8-methyl-5-thia-1,8,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,9,11-tetraen-7-one |
|---|---|
| PubChem CID | 55828974 |
| Molecular Formula | C23H27N5O2S |
| Molecular Weight | 437.57 g/mol |
| Exact Mass | 437.19 |
| IUPAC Name | 12-[[4-[2-(4-methoxyphenyl)ethyl]piperidin-1-yl]methyl]-8-methyl-5-thia-1,8,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,9,11-tetraen-7-one |
| SMILES | COc1ccc(CCC2CCN(Cc3nnc4n(C)c(=O)c5sccc5n34)CC2)cc1 |
| InChI | InChI=1S/C23H27N5O2S/c1-26-22(29)21-19(11-14-31-21)28-20(24-25-23(26)28)15-27-12-9-17(10-13-27)4-3-16-5-7-18(30-2)8-6-16/h5-8,11,14,17H,3-4,9-10,12-13,15H2,1-2H3 |
| InChIKey | RIJWRWPUBYMDOE-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 64.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.57 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |