C13H14Cl4N2O2 — CID 60509941
2-[cyclopropyl(2-hydroxyethyl)amino]-N-(2,3,5,6-tetrachlorophenyl)acetamide (PubChem CID 60509941) has the molecular formula C13H14Cl4N2O2 and a molecular weight of 372.08 g/mol. Its IUPAC name is 2-[cyclopropyl(2-hydroxyethyl)amino]-N-(2,3,5,6-tetrachlorophenyl)acetamide.
| Compound Name | 2-[cyclopropyl(2-hydroxyethyl)amino]-N-(2,3,5,6-tetrachlorophenyl)acetamide |
|---|---|
| PubChem CID | 60509941 |
| Molecular Formula | C13H14Cl4N2O2 |
| Molecular Weight | 372.08 g/mol |
| Exact Mass | 369.98 |
| IUPAC Name | 2-[cyclopropyl(2-hydroxyethyl)amino]-N-(2,3,5,6-tetrachlorophenyl)acetamide |
| SMILES | O=C(CN(CCO)C1CC1)Nc1c(Cl)c(Cl)cc(Cl)c1Cl |
| InChI | InChI=1S/C13H14Cl4N2O2/c14-8-5-9(15)12(17)13(11(8)16)18-10(21)6-19(3-4-20)7-1-2-7/h5,7,20H,1-4,6H2,(H,18,21) |
| InChIKey | FAXILLRPQPHWKM-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.08 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|