C19H18BrNO3 — CID 60513206
N-(4-bromo-2-hydroxyphenyl)-4-(2,3-dihydro-1H-inden-5-yl)-4-oxobutanamide (PubChem CID 60513206) has the molecular formula C19H18BrNO3 and a molecular weight of 388.26 g/mol. Its IUPAC name is N-(4-bromo-2-hydroxyphenyl)-4-(2,3-dihydro-1H-inden-5-yl)-4-oxobutanamide.
| Compound Name | N-(4-bromo-2-hydroxyphenyl)-4-(2,3-dihydro-1H-inden-5-yl)-4-oxobutanamide |
|---|---|
| PubChem CID | 60513206 |
| Molecular Formula | C19H18BrNO3 |
| Molecular Weight | 388.26 g/mol |
| Exact Mass | 387.05 |
| IUPAC Name | N-(4-bromo-2-hydroxyphenyl)-4-(2,3-dihydro-1H-inden-5-yl)-4-oxobutanamide |
| SMILES | O=C(CCC(=O)c1ccc2c(c1)CCC2)Nc1ccc(Br)cc1O |
| InChI | InChI=1S/C19H18BrNO3/c20-15-6-7-16(18(23)11-15)21-19(24)9-8-17(22)14-5-4-12-2-1-3-13(12)10-14/h4-7,10-11,23H,1-3,8-9H2,(H,21,24) |
| InChIKey | LKFWDKJJDRVQDI-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.26 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|