C24H25BrN2O4 — CID 60523505
ethyl (E)-2-(1-benzylimidazol-2-yl)-3-(3-bromo-4-ethoxy-5-methoxyphenyl)prop-2-enoate (PubChem CID 60523505) has the molecular formula C24H25BrN2O4 and a molecular weight of 485.38 g/mol. Its IUPAC name is ethyl (E)-2-(1-benzylimidazol-2-yl)-3-(3-bromo-4-ethoxy-5-methoxyphenyl)prop-2-enoate.
| Compound Name | ethyl (E)-2-(1-benzylimidazol-2-yl)-3-(3-bromo-4-ethoxy-5-methoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 60523505 |
| Molecular Formula | C24H25BrN2O4 |
| Molecular Weight | 485.38 g/mol |
| Exact Mass | 484.10 |
| IUPAC Name | ethyl (E)-2-(1-benzylimidazol-2-yl)-3-(3-bromo-4-ethoxy-5-methoxyphenyl)prop-2-enoate |
| SMILES | CCOC(=O)/C(=C/c1cc(Br)c(OCC)c(OC)c1)c1nccn1Cc1ccccc1 |
| InChI | InChI=1S/C24H25BrN2O4/c1-4-30-22-20(25)14-18(15-21(22)29-3)13-19(24(28)31-5-2)23-26-11-12-27(23)16-17-9-7-6-8-10-17/h6-15H,4-5,16H2,1-3H3/b19-13+ |
| InChIKey | PMKFGBQYQPWSJA-CPNJWEJPSA-N |
| XLogP | 5.20 |
| TPSA | 62.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.38 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|