C18H17N3O2S — CID 60525800
3-[5-(1,3-benzothiazol-2-yl)furan-2-yl]-3,5,6,7,8,8a-hexahydro-2H-imidazo[1,5-a]pyridin-1-one (PubChem CID 60525800) has the molecular formula C18H17N3O2S and a molecular weight of 339.42 g/mol. Its IUPAC name is 3-[5-(1,3-benzothiazol-2-yl)furan-2-yl]-3,5,6,7,8,8a-hexahydro-2H-imidazo[1,5-a]pyridin-1-one.
| Compound Name | 3-[5-(1,3-benzothiazol-2-yl)furan-2-yl]-3,5,6,7,8,8a-hexahydro-2H-imidazo[1,5-a]pyridin-1-one |
|---|---|
| PubChem CID | 60525800 |
| Molecular Formula | C18H17N3O2S |
| Molecular Weight | 339.42 g/mol |
| Exact Mass | 339.10 |
| IUPAC Name | 3-[5-(1,3-benzothiazol-2-yl)furan-2-yl]-3,5,6,7,8,8a-hexahydro-2H-imidazo[1,5-a]pyridin-1-one |
| SMILES | O=C1NC(c2ccc(-c3nc4ccccc4s3)o2)N2CCCCC12 |
| InChI | InChI=1S/C18H17N3O2S/c22-17-12-6-3-4-10-21(12)16(20-17)13-8-9-14(23-13)18-19-11-5-1-2-7-15(11)24-18/h1-2,5,7-9,12,16H,3-4,6,10H2,(H,20,22) |
| InChIKey | LGIHMJKCZLBTJI-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 58.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.42 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |