C16H15BrN2OS — CID 126195533
2-(4-bromo-5-piperidin-1-ylfuran-2-yl)-1,3-benzothiazole (PubChem CID 126195533) has the molecular formula C16H15BrN2OS and a molecular weight of 363.28 g/mol. Its IUPAC name is 2-(4-bromo-5-piperidin-1-ylfuran-2-yl)-1,3-benzothiazole.
| Compound Name | 2-(4-bromo-5-piperidin-1-ylfuran-2-yl)-1,3-benzothiazole |
|---|---|
| PubChem CID | 126195533 |
| Molecular Formula | C16H15BrN2OS |
| Molecular Weight | 363.28 g/mol |
| Exact Mass | 362.01 |
| IUPAC Name | 2-(4-bromo-5-piperidin-1-ylfuran-2-yl)-1,3-benzothiazole |
| SMILES | Brc1cc(-c2nc3ccccc3s2)oc1N1CCCCC1 |
| InChI | InChI=1S/C16H15BrN2OS/c17-11-10-13(20-16(11)19-8-4-1-5-9-19)15-18-12-6-2-3-7-14(12)21-15/h2-3,6-7,10H,1,4-5,8-9H2 |
| InChIKey | OVVFUJBUFZLKOV-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 29.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.28 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |