C17H19BrN2O4S — CID 60533341
N-[4-[(5-bromo-2-methoxyphenyl)sulfamoyl]-3,5-dimethylphenyl]acetamide (PubChem CID 60533341) has the molecular formula C17H19BrN2O4S and a molecular weight of 427.32 g/mol. Its IUPAC name is N-[4-[(5-bromo-2-methoxyphenyl)sulfamoyl]-3,5-dimethylphenyl]acetamide.
| Compound Name | N-[4-[(5-bromo-2-methoxyphenyl)sulfamoyl]-3,5-dimethylphenyl]acetamide |
|---|---|
| PubChem CID | 60533341 |
| Molecular Formula | C17H19BrN2O4S |
| Molecular Weight | 427.32 g/mol |
| Exact Mass | 426.02 |
| IUPAC Name | N-[4-[(5-bromo-2-methoxyphenyl)sulfamoyl]-3,5-dimethylphenyl]acetamide |
| SMILES | COc1ccc(Br)cc1NS(=O)(=O)c1c(C)cc(NC(C)=O)cc1C |
| InChI | InChI=1S/C17H19BrN2O4S/c1-10-7-14(19-12(3)21)8-11(2)17(10)25(22,23)20-15-9-13(18)5-6-16(15)24-4/h5-9,20H,1-4H3,(H,19,21) |
| InChIKey | MHHWUAGPGSIECQ-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.32 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |