C24H20FN3O3 — CID 60535776
(E)-3-[4-(cyanomethoxy)-3-methoxyphenyl]-N-(4-fluorophenyl)-N-(pyridin-2-ylmethyl)prop-2-enamide (PubChem CID 60535776) has the molecular formula C24H20FN3O3 and a molecular weight of 417.44 g/mol. Its IUPAC name is (E)-3-[4-(cyanomethoxy)-3-methoxyphenyl]-N-(4-fluorophenyl)-N-(pyridin-2-ylmethyl)prop-2-enamide.
| Compound Name | (E)-3-[4-(cyanomethoxy)-3-methoxyphenyl]-N-(4-fluorophenyl)-N-(pyridin-2-ylmethyl)prop-2-enamide |
|---|---|
| PubChem CID | 60535776 |
| Molecular Formula | C24H20FN3O3 |
| Molecular Weight | 417.44 g/mol |
| Exact Mass | 417.15 |
| IUPAC Name | (E)-3-[4-(cyanomethoxy)-3-methoxyphenyl]-N-(4-fluorophenyl)-N-(pyridin-2-ylmethyl)prop-2-enamide |
| SMILES | COc1cc(/C=C/C(=O)N(Cc2ccccn2)c2ccc(F)cc2)ccc1OCC#N |
| InChI | InChI=1S/C24H20FN3O3/c1-30-23-16-18(5-11-22(23)31-15-13-26)6-12-24(29)28(17-20-4-2-3-14-27-20)21-9-7-19(25)8-10-21/h2-12,14,16H,15,17H2,1H3/b12-6+ |
| InChIKey | ALBWGIOGYWCGKD-WUXMJOGZSA-N |
| XLogP | 4.38 |
| TPSA | 75.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.44 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|