C20H18ClFN2O3 — CID 30278837
(E)-N-[(2-chloro-6-fluorophenyl)methyl]-3-[4-(cyanomethoxy)-3-methoxyphenyl]-N-methylprop-2-enamide (PubChem CID 30278837) has the molecular formula C20H18ClFN2O3 and a molecular weight of 388.83 g/mol. Its IUPAC name is (E)-N-[(2-chloro-6-fluorophenyl)methyl]-3-[4-(cyanomethoxy)-3-methoxyphenyl]-N-methylprop-2-enamide.
| Compound Name | (E)-N-[(2-chloro-6-fluorophenyl)methyl]-3-[4-(cyanomethoxy)-3-methoxyphenyl]-N-methylprop-2-enamide |
|---|---|
| PubChem CID | 30278837 |
| Molecular Formula | C20H18ClFN2O3 |
| Molecular Weight | 388.83 g/mol |
| Exact Mass | 388.10 |
| IUPAC Name | (E)-N-[(2-chloro-6-fluorophenyl)methyl]-3-[4-(cyanomethoxy)-3-methoxyphenyl]-N-methylprop-2-enamide |
| SMILES | COc1cc(/C=C/C(=O)N(C)Cc2c(F)cccc2Cl)ccc1OCC#N |
| InChI | InChI=1S/C20H18ClFN2O3/c1-24(13-15-16(21)4-3-5-17(15)22)20(25)9-7-14-6-8-18(27-11-10-23)19(12-14)26-2/h3-9,12H,11,13H2,1-2H3/b9-7+ |
| InChIKey | MCANCDCMOCSLMD-VQHVLOKHSA-N |
| XLogP | 4.06 |
| TPSA | 62.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.83 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|