C24H21ClN4O3 — CID 60535988
N-(4-chlorophenyl)-2-(4-methyl-2,5-dioxo-4-phenylimidazolidin-1-yl)-N-(pyridin-2-ylmethyl)acetamide (PubChem CID 60535988) has the molecular formula C24H21ClN4O3 and a molecular weight of 448.91 g/mol. Its IUPAC name is N-(4-chlorophenyl)-2-(4-methyl-2,5-dioxo-4-phenylimidazolidin-1-yl)-N-(pyridin-2-ylmethyl)acetamide.
| Compound Name | N-(4-chlorophenyl)-2-(4-methyl-2,5-dioxo-4-phenylimidazolidin-1-yl)-N-(pyridin-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 60535988 |
| Molecular Formula | C24H21ClN4O3 |
| Molecular Weight | 448.91 g/mol |
| Exact Mass | 448.13 |
| IUPAC Name | N-(4-chlorophenyl)-2-(4-methyl-2,5-dioxo-4-phenylimidazolidin-1-yl)-N-(pyridin-2-ylmethyl)acetamide |
| SMILES | CC1(c2ccccc2)NC(=O)N(CC(=O)N(Cc2ccccn2)c2ccc(Cl)cc2)C1=O |
| InChI | InChI=1S/C24H21ClN4O3/c1-24(17-7-3-2-4-8-17)22(31)29(23(32)27-24)16-21(30)28(15-19-9-5-6-14-26-19)20-12-10-18(25)11-13-20/h2-14H,15-16H2,1H3,(H,27,32) |
| InChIKey | PPBIXLMZWFZBAO-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 82.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.91 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|