C16H25N3O3S — CID 6053899
N-[(Z)-3,3-dimethylbutan-2-ylideneamino]-2-(2-methyl-N-methylsulfonylanilino)acetamide (PubChem CID 6053899) has the molecular formula C16H25N3O3S and a molecular weight of 339.46 g/mol. Its IUPAC name is N-[(Z)-3,3-dimethylbutan-2-ylideneamino]-2-(2-methyl-N-methylsulfonylanilino)acetamide.
| Compound Name | N-[(Z)-3,3-dimethylbutan-2-ylideneamino]-2-(2-methyl-N-methylsulfonylanilino)acetamide |
|---|---|
| PubChem CID | 6053899 |
| Molecular Formula | C16H25N3O3S |
| Molecular Weight | 339.46 g/mol |
| Exact Mass | 339.16 |
| IUPAC Name | N-[(Z)-3,3-dimethylbutan-2-ylideneamino]-2-(2-methyl-N-methylsulfonylanilino)acetamide |
| SMILES | C/C(=N/NC(=O)CN(c1ccccc1C)S(C)(=O)=O)C(C)(C)C |
| InChI | InChI=1S/C16H25N3O3S/c1-12-9-7-8-10-14(12)19(23(6,21)22)11-15(20)18-17-13(2)16(3,4)5/h7-10H,11H2,1-6H3,(H,18,20)/b17-13- |
| InChIKey | LTCUHFAVFDLNCJ-LGMDPLHJSA-N |
| XLogP | 2.30 |
| TPSA | 78.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.46 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|