C15H8BrN5O4S — CID 60546581
3-[[3-(4-bromothiophen-2-yl)-1,2,4-oxadiazol-5-yl]methyl]-6-nitroquinazolin-4-one (PubChem CID 60546581) has the molecular formula C15H8BrN5O4S and a molecular weight of 434.23 g/mol. Its IUPAC name is 3-[[3-(4-bromothiophen-2-yl)-1,2,4-oxadiazol-5-yl]methyl]-6-nitroquinazolin-4-one.
| Compound Name | 3-[[3-(4-bromothiophen-2-yl)-1,2,4-oxadiazol-5-yl]methyl]-6-nitroquinazolin-4-one |
|---|---|
| PubChem CID | 60546581 |
| Molecular Formula | C15H8BrN5O4S |
| Molecular Weight | 434.23 g/mol |
| Exact Mass | 432.95 |
| IUPAC Name | 3-[[3-(4-bromothiophen-2-yl)-1,2,4-oxadiazol-5-yl]methyl]-6-nitroquinazolin-4-one |
| SMILES | O=c1c2cc([N+](=O)[O-])ccc2ncn1Cc1nc(-c2cc(Br)cs2)no1 |
| InChI | InChI=1S/C15H8BrN5O4S/c16-8-3-12(26-6-8)14-18-13(25-19-14)5-20-7-17-11-2-1-9(21(23)24)4-10(11)15(20)22/h1-4,6-7H,5H2 |
| InChIKey | IEGHVIRAKSGBDT-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 116.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.23 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|