C15H7BrN4O5S — CID 60546608
2-[[3-(4-bromothiophen-2-yl)-1,2,4-oxadiazol-5-yl]methyl]-4-nitroisoindole-1,3-dione (PubChem CID 60546608) has the molecular formula C15H7BrN4O5S and a molecular weight of 435.22 g/mol. Its IUPAC name is 2-[[3-(4-bromothiophen-2-yl)-1,2,4-oxadiazol-5-yl]methyl]-4-nitroisoindole-1,3-dione.
| Compound Name | 2-[[3-(4-bromothiophen-2-yl)-1,2,4-oxadiazol-5-yl]methyl]-4-nitroisoindole-1,3-dione |
|---|---|
| PubChem CID | 60546608 |
| Molecular Formula | C15H7BrN4O5S |
| Molecular Weight | 435.22 g/mol |
| Exact Mass | 433.93 |
| IUPAC Name | 2-[[3-(4-bromothiophen-2-yl)-1,2,4-oxadiazol-5-yl]methyl]-4-nitroisoindole-1,3-dione |
| SMILES | O=C1c2cccc([N+](=O)[O-])c2C(=O)N1Cc1nc(-c2cc(Br)cs2)no1 |
| InChI | InChI=1S/C15H7BrN4O5S/c16-7-4-10(26-6-7)13-17-11(25-18-13)5-19-14(21)8-2-1-3-9(20(23)24)12(8)15(19)22/h1-4,6H,5H2 |
| InChIKey | OQTSITYIUPBQKY-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 119.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.22 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|