About 2-[[5-(3-chlorophenyl)-1,3-oxazol-2-yl]methyl]-4-nitroisoindole-1,3-dione
2-[[5-(3-chlorophenyl)-1,3-oxazol-2-yl]methyl]-4-nitroisoindole-1,3-dione (PubChem CID 35498151) has the molecular formula C18H10ClN3O5
and a molecular weight of 383.75 g/mol. Its IUPAC name is 2-[[5-(3-chlorophenyl)-1,3-oxazol-2-yl]methyl]-4-nitroisoindole-1,3-dione.
Molecular Properties
| Compound Name | 2-[[5-(3-chlorophenyl)-1,3-oxazol-2-yl]methyl]-4-nitroisoindole-1,3-dione |
| PubChem CID | 35498151 |
| Molecular Formula | C18H10ClN3O5 |
| Molecular Weight | 383.75 g/mol |
| Exact Mass | 383.03 |
| IUPAC Name | 2-[[5-(3-chlorophenyl)-1,3-oxazol-2-yl]methyl]-4-nitroisoindole-1,3-dione |
| SMILES | O=C1c2cccc([N+](=O)[O-])c2C(=O)N1Cc1ncc(-c2cccc(Cl)c2)o1 |
| InChI | InChI=1S/C18H10ClN3O5/c19-11-4-1-3-10(7-11)14-8-20-15(27-14)9-21-17(23)12-5-2-6-13(22(25)26)16(12)18(21)24/h1-8H,9H2 |
| InChIKey | NJDYZIJZIGKKEQ-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 106.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 383.75 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 2-[[5-(3-chlorophenyl)-1,3-oxazol-2-yl]methyl]-4-nitroisoindole-1,3-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[5-(3-chlorophenyl)-1,3-oxazol-2-yl]methyl]-4-nitroisoindole-1,3-dione?
The IUPAC name of 2-[[5-(3-chlorophenyl)-1,3-oxazol-2-yl]methyl]-4-nitroisoindole-1,3-dione (CID 35498151) is 2-[[5-(3-chlorophenyl)-1,3-oxazol-2-yl]methyl]-4-nitroisoindole-1,3-dione.
What is the SMILES notation for 2-[[5-(3-chlorophenyl)-1,3-oxazol-2-yl]methyl]-4-nitroisoindole-1,3-dione?
The canonical SMILES for 2-[[5-(3-chlorophenyl)-1,3-oxazol-2-yl]methyl]-4-nitroisoindole-1,3-dione is O=C1c2cccc([N+](=O)[O-])c2C(=O)N1Cc1ncc(-c2cccc(Cl)c2)o1.
What is the InChIKey of 2-[[5-(3-chlorophenyl)-1,3-oxazol-2-yl]methyl]-4-nitroisoindole-1,3-dione?
The InChIKey is NJDYZIJZIGKKEQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H10ClN3O5/c19-11-4-1-3-10(7-11)14-8-20-15(27-14)9-21-17(23)12-5-2-6-13(22(25)26)16(12)18(21)24/h1-8H,9H2.
What are the key properties of 2-[[5-(3-chlorophenyl)-1,3-oxazol-2-yl]methyl]-4-nitroisoindole-1,3-dione?
2-[[5-(3-chlorophenyl)-1,3-oxazol-2-yl]methyl]-4-nitroisoindole-1,3-dione has a molecular weight of 383.75 g/mol, XLogP of 3.70, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[5-(3-chlorophenyl)-1,3-oxazol-2-yl]methyl]-4-nitroisoindole-1,3-dione is sourced from PubChem (CID 35498151), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).