C15H10FN3O4 — CID 71970701
1-[[5-(3-fluorophenyl)-1,3-oxazol-2-yl]methyl]-3-nitropyridin-4-one (PubChem CID 71970701) has the molecular formula C15H10FN3O4 and a molecular weight of 315.26 g/mol. Its IUPAC name is 1-[[5-(3-fluorophenyl)-1,3-oxazol-2-yl]methyl]-3-nitropyridin-4-one.
| Compound Name | 1-[[5-(3-fluorophenyl)-1,3-oxazol-2-yl]methyl]-3-nitropyridin-4-one |
|---|---|
| PubChem CID | 71970701 |
| Molecular Formula | C15H10FN3O4 |
| Molecular Weight | 315.26 g/mol |
| Exact Mass | 315.07 |
| IUPAC Name | 1-[[5-(3-fluorophenyl)-1,3-oxazol-2-yl]methyl]-3-nitropyridin-4-one |
| SMILES | O=c1ccn(Cc2ncc(-c3cccc(F)c3)o2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C15H10FN3O4/c16-11-3-1-2-10(6-11)14-7-17-15(23-14)9-18-5-4-13(20)12(8-18)19(21)22/h1-8H,9H2 |
| InChIKey | SDYAQLYAQKWDMT-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 91.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.26 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|