C20H18FN3O4 — CID 60554186
N-[2-[[2-(3-fluorophenoxy)phenyl]carbamoylamino]ethyl]furan-2-carboxamide (PubChem CID 60554186) has the molecular formula C20H18FN3O4 and a molecular weight of 383.38 g/mol. Its IUPAC name is N-[2-[[2-(3-fluorophenoxy)phenyl]carbamoylamino]ethyl]furan-2-carboxamide.
| Compound Name | N-[2-[[2-(3-fluorophenoxy)phenyl]carbamoylamino]ethyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 60554186 |
| Molecular Formula | C20H18FN3O4 |
| Molecular Weight | 383.38 g/mol |
| Exact Mass | 383.13 |
| IUPAC Name | N-[2-[[2-(3-fluorophenoxy)phenyl]carbamoylamino]ethyl]furan-2-carboxamide |
| SMILES | O=C(NCCNC(=O)c1ccco1)Nc1ccccc1Oc1cccc(F)c1 |
| InChI | InChI=1S/C20H18FN3O4/c21-14-5-3-6-15(13-14)28-17-8-2-1-7-16(17)24-20(26)23-11-10-22-19(25)18-9-4-12-27-18/h1-9,12-13H,10-11H2,(H,22,25)(H2,23,24,26) |
| InChIKey | DENWMBWFWQAJFO-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 92.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.38 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|