C20H24FNO4S — CID 60554783
4-(2-fluorophenoxy)-N-(2,3,5,6-tetramethylphenyl)sulfonylbutanamide (PubChem CID 60554783) has the molecular formula C20H24FNO4S and a molecular weight of 393.48 g/mol. Its IUPAC name is 4-(2-fluorophenoxy)-N-(2,3,5,6-tetramethylphenyl)sulfonylbutanamide.
| Compound Name | 4-(2-fluorophenoxy)-N-(2,3,5,6-tetramethylphenyl)sulfonylbutanamide |
|---|---|
| PubChem CID | 60554783 |
| Molecular Formula | C20H24FNO4S |
| Molecular Weight | 393.48 g/mol |
| Exact Mass | 393.14 |
| IUPAC Name | 4-(2-fluorophenoxy)-N-(2,3,5,6-tetramethylphenyl)sulfonylbutanamide |
| SMILES | Cc1cc(C)c(C)c(S(=O)(=O)NC(=O)CCCOc2ccccc2F)c1C |
| InChI | InChI=1S/C20H24FNO4S/c1-13-12-14(2)16(4)20(15(13)3)27(24,25)22-19(23)10-7-11-26-18-9-6-5-8-17(18)21/h5-6,8-9,12H,7,10-11H2,1-4H3,(H,22,23) |
| InChIKey | MYGIPWIWWSHOLT-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.48 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|