C27H31FN4O3 — CID 60555157
N-[4-fluoro-3-(3-morpholin-4-ylpropanoylamino)phenyl]-6-methyl-6,7,8,9-tetrahydro-5H-carbazole-1-carboxamide (PubChem CID 60555157) has the molecular formula C27H31FN4O3 and a molecular weight of 478.57 g/mol. Its IUPAC name is N-[4-fluoro-3-(3-morpholin-4-ylpropanoylamino)phenyl]-6-methyl-6,7,8,9-tetrahydro-5H-carbazole-1-carboxamide.
| Compound Name | N-[4-fluoro-3-(3-morpholin-4-ylpropanoylamino)phenyl]-6-methyl-6,7,8,9-tetrahydro-5H-carbazole-1-carboxamide |
|---|---|
| PubChem CID | 60555157 |
| Molecular Formula | C27H31FN4O3 |
| Molecular Weight | 478.57 g/mol |
| Exact Mass | 478.24 |
| IUPAC Name | N-[4-fluoro-3-(3-morpholin-4-ylpropanoylamino)phenyl]-6-methyl-6,7,8,9-tetrahydro-5H-carbazole-1-carboxamide |
| SMILES | CC1CCc2[nH]c3c(C(=O)Nc4ccc(F)c(NC(=O)CCN5CCOCC5)c4)cccc3c2C1 |
| InChI | InChI=1S/C27H31FN4O3/c1-17-5-8-23-21(15-17)19-3-2-4-20(26(19)31-23)27(34)29-18-6-7-22(28)24(16-18)30-25(33)9-10-32-11-13-35-14-12-32/h2-4,6-7,16-17,31H,5,8-15H2,1H3,(H,29,34)(H,30,33) |
| InChIKey | GPHXJPZTAPLCHU-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 86.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.57 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|