C15H23FN2OS — CID 60559393
N-[2-(dimethylamino)ethyl]-N-[(4-fluorophenyl)methyl]-2-methylsulfanylpropanamide (PubChem CID 60559393) has the molecular formula C15H23FN2OS and a molecular weight of 298.43 g/mol. Its IUPAC name is N-[2-(dimethylamino)ethyl]-N-[(4-fluorophenyl)methyl]-2-methylsulfanylpropanamide.
| Compound Name | N-[2-(dimethylamino)ethyl]-N-[(4-fluorophenyl)methyl]-2-methylsulfanylpropanamide |
|---|---|
| PubChem CID | 60559393 |
| Molecular Formula | C15H23FN2OS |
| Molecular Weight | 298.43 g/mol |
| Exact Mass | 298.15 |
| IUPAC Name | N-[2-(dimethylamino)ethyl]-N-[(4-fluorophenyl)methyl]-2-methylsulfanylpropanamide |
| SMILES | CSC(C)C(=O)N(CCN(C)C)Cc1ccc(F)cc1 |
| InChI | InChI=1S/C15H23FN2OS/c1-12(20-4)15(19)18(10-9-17(2)3)11-13-5-7-14(16)8-6-13/h5-8,12H,9-11H2,1-4H3 |
| InChIKey | UIADXJLZXKWBML-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.43 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |