C14H24F3N3O2 — CID 60567863
N-prop-2-enyl-2-[4-[3-(2,2,2-trifluoroethoxy)propyl]piperazin-1-yl]acetamide (PubChem CID 60567863) has the molecular formula C14H24F3N3O2 and a molecular weight of 323.36 g/mol. Its IUPAC name is N-prop-2-enyl-2-[4-[3-(2,2,2-trifluoroethoxy)propyl]piperazin-1-yl]acetamide.
| Compound Name | N-prop-2-enyl-2-[4-[3-(2,2,2-trifluoroethoxy)propyl]piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 60567863 |
| Molecular Formula | C14H24F3N3O2 |
| Molecular Weight | 323.36 g/mol |
| Exact Mass | 323.18 |
| IUPAC Name | N-prop-2-enyl-2-[4-[3-(2,2,2-trifluoroethoxy)propyl]piperazin-1-yl]acetamide |
| SMILES | C=CCNC(=O)CN1CCN(CCCOCC(F)(F)F)CC1 |
| InChI | InChI=1S/C14H24F3N3O2/c1-2-4-18-13(21)11-20-8-6-19(7-9-20)5-3-10-22-12-14(15,16)17/h2H,1,3-12H2,(H,18,21) |
| InChIKey | RITHSOZMQFHRFF-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.36 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|