C21H23BrFN3O2 — CID 60582798
[4-(5-bromo-2-pyridinyl)piperazin-1-yl]-[4-(3-fluorophenyl)oxan-4-yl]methanone (PubChem CID 60582798) has the molecular formula C21H23BrFN3O2 and a molecular weight of 448.34 g/mol. Its IUPAC name is [4-(5-bromo-2-pyridinyl)piperazin-1-yl]-[4-(3-fluorophenyl)oxan-4-yl]methanone.
| Compound Name | [4-(5-bromo-2-pyridinyl)piperazin-1-yl]-[4-(3-fluorophenyl)oxan-4-yl]methanone |
|---|---|
| PubChem CID | 60582798 |
| Molecular Formula | C21H23BrFN3O2 |
| Molecular Weight | 448.34 g/mol |
| Exact Mass | 447.10 |
| IUPAC Name | [4-(5-bromo-2-pyridinyl)piperazin-1-yl]-[4-(3-fluorophenyl)oxan-4-yl]methanone |
| SMILES | O=C(N1CCN(c2ccc(Br)cn2)CC1)C1(c2cccc(F)c2)CCOCC1 |
| InChI | InChI=1S/C21H23BrFN3O2/c22-17-4-5-19(24-15-17)25-8-10-26(11-9-25)20(27)21(6-12-28-13-7-21)16-2-1-3-18(23)14-16/h1-5,14-15H,6-13H2 |
| InChIKey | NGKLUPXPZSZNGJ-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.34 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |