C22H21N5O2S — CID 60592484
4-oxo-3-pentyl-N-(5-phenyl-1,3,4-thiadiazol-2-yl)phthalazine-1-carboxamide (PubChem CID 60592484) has the molecular formula C22H21N5O2S and a molecular weight of 419.51 g/mol. Its IUPAC name is 4-oxo-3-pentyl-N-(5-phenyl-1,3,4-thiadiazol-2-yl)phthalazine-1-carboxamide.
| Compound Name | 4-oxo-3-pentyl-N-(5-phenyl-1,3,4-thiadiazol-2-yl)phthalazine-1-carboxamide |
|---|---|
| PubChem CID | 60592484 |
| Molecular Formula | C22H21N5O2S |
| Molecular Weight | 419.51 g/mol |
| Exact Mass | 419.14 |
| IUPAC Name | 4-oxo-3-pentyl-N-(5-phenyl-1,3,4-thiadiazol-2-yl)phthalazine-1-carboxamide |
| SMILES | CCCCCn1nc(C(=O)Nc2nnc(-c3ccccc3)s2)c2ccccc2c1=O |
| InChI | InChI=1S/C22H21N5O2S/c1-2-3-9-14-27-21(29)17-13-8-7-12-16(17)18(26-27)19(28)23-22-25-24-20(30-22)15-10-5-4-6-11-15/h4-8,10-13H,2-3,9,14H2,1H3,(H,23,25,28) |
| InChIKey | WPAXLAMPEUDZQE-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 89.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.51 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|