C17H17N5O2S2 — CID 4827568
4-oxo-N-(5-prop-2-enylsulfanyl-1,3,4-thiadiazol-2-yl)-3-propylphthalazine-1-carboxamide (PubChem CID 4827568) has the molecular formula C17H17N5O2S2 and a molecular weight of 387.49 g/mol. Its IUPAC name is 4-oxo-N-(5-prop-2-enylsulfanyl-1,3,4-thiadiazol-2-yl)-3-propylphthalazine-1-carboxamide.
| Compound Name | 4-oxo-N-(5-prop-2-enylsulfanyl-1,3,4-thiadiazol-2-yl)-3-propylphthalazine-1-carboxamide |
|---|---|
| PubChem CID | 4827568 |
| Molecular Formula | C17H17N5O2S2 |
| Molecular Weight | 387.49 g/mol |
| Exact Mass | 387.08 |
| IUPAC Name | 4-oxo-N-(5-prop-2-enylsulfanyl-1,3,4-thiadiazol-2-yl)-3-propylphthalazine-1-carboxamide |
| SMILES | C=CCSc1nnc(NC(=O)c2nn(CCC)c(=O)c3ccccc23)s1 |
| InChI | InChI=1S/C17H17N5O2S2/c1-3-9-22-15(24)12-8-6-5-7-11(12)13(21-22)14(23)18-16-19-20-17(26-16)25-10-4-2/h4-8H,2-3,9-10H2,1H3,(H,18,19,23) |
| InChIKey | BXGLGQHCOAHQLN-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 89.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.49 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|