C16H14F3NO3S — CID 60593352
2-[3-(1,3-benzodioxol-5-yloxy)propylsulfanyl]-5-(trifluoromethyl)pyridine (PubChem CID 60593352) has the molecular formula C16H14F3NO3S and a molecular weight of 357.35 g/mol. Its IUPAC name is 2-[3-(1,3-benzodioxol-5-yloxy)propylsulfanyl]-5-(trifluoromethyl)pyridine.
| Compound Name | 2-[3-(1,3-benzodioxol-5-yloxy)propylsulfanyl]-5-(trifluoromethyl)pyridine |
|---|---|
| PubChem CID | 60593352 |
| Molecular Formula | C16H14F3NO3S |
| Molecular Weight | 357.35 g/mol |
| Exact Mass | 357.06 |
| IUPAC Name | 2-[3-(1,3-benzodioxol-5-yloxy)propylsulfanyl]-5-(trifluoromethyl)pyridine |
| SMILES | FC(F)(F)c1ccc(SCCCOc2ccc3c(c2)OCO3)nc1 |
| InChI | InChI=1S/C16H14F3NO3S/c17-16(18,19)11-2-5-15(20-9-11)24-7-1-6-21-12-3-4-13-14(8-12)23-10-22-13/h2-5,8-9H,1,6-7,10H2 |
| InChIKey | DDRSIJWDSZZQGZ-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 40.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.35 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|