C22H26F3N3O3S — CID 6059713
N-[(Z)-(4-methyl-4-phenylpentan-2-ylidene)amino]-2-[N-methylsulfonyl-3-(trifluoromethyl)anilino]acetamide (PubChem CID 6059713) has the molecular formula C22H26F3N3O3S and a molecular weight of 469.53 g/mol. Its IUPAC name is N-[(Z)-(4-methyl-4-phenylpentan-2-ylidene)amino]-2-[N-methylsulfonyl-3-(trifluoromethyl)anilino]acetamide.
| Compound Name | N-[(Z)-(4-methyl-4-phenylpentan-2-ylidene)amino]-2-[N-methylsulfonyl-3-(trifluoromethyl)anilino]acetamide |
|---|---|
| PubChem CID | 6059713 |
| Molecular Formula | C22H26F3N3O3S |
| Molecular Weight | 469.53 g/mol |
| Exact Mass | 469.16 |
| IUPAC Name | N-[(Z)-(4-methyl-4-phenylpentan-2-ylidene)amino]-2-[N-methylsulfonyl-3-(trifluoromethyl)anilino]acetamide |
| SMILES | C/C(CC(C)(C)c1ccccc1)=N/NC(=O)CN(c1cccc(C(F)(F)F)c1)S(C)(=O)=O |
| InChI | InChI=1S/C22H26F3N3O3S/c1-16(14-21(2,3)17-9-6-5-7-10-17)26-27-20(29)15-28(32(4,30)31)19-12-8-11-18(13-19)22(23,24)25/h5-13H,14-15H2,1-4H3,(H,27,29)/b26-16- |
| InChIKey | IVMATNDKJGOSIA-QQXSKIMKSA-N |
| XLogP | 4.33 |
| TPSA | 78.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.53 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|