C20H22F3N3O3S — CID 60604981
3-(benzylsulfamoyl)-N-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]benzamide (PubChem CID 60604981) has the molecular formula C20H22F3N3O3S and a molecular weight of 441.48 g/mol. Its IUPAC name is 3-(benzylsulfamoyl)-N-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]benzamide.
| Compound Name | 3-(benzylsulfamoyl)-N-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]benzamide |
|---|---|
| PubChem CID | 60604981 |
| Molecular Formula | C20H22F3N3O3S |
| Molecular Weight | 441.48 g/mol |
| Exact Mass | 441.13 |
| IUPAC Name | 3-(benzylsulfamoyl)-N-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]benzamide |
| SMILES | O=C(NC1CCN(CC(F)(F)F)C1)c1cccc(S(=O)(=O)NCc2ccccc2)c1 |
| InChI | InChI=1S/C20H22F3N3O3S/c21-20(22,23)14-26-10-9-17(13-26)25-19(27)16-7-4-8-18(11-16)30(28,29)24-12-15-5-2-1-3-6-15/h1-8,11,17,24H,9-10,12-14H2,(H,25,27) |
| InChIKey | XRVXHHGEGYCNAW-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.48 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |