C16H13F5N4S — CID 60606986
2-[[1-(difluoromethyl)imidazol-2-yl]methylsulfanyl]-5-phenyl-1-(2,2,2-trifluoroethyl)imidazole (PubChem CID 60606986) has the molecular formula C16H13F5N4S and a molecular weight of 388.37 g/mol. Its IUPAC name is 2-[[1-(difluoromethyl)imidazol-2-yl]methylsulfanyl]-5-phenyl-1-(2,2,2-trifluoroethyl)imidazole.
| Compound Name | 2-[[1-(difluoromethyl)imidazol-2-yl]methylsulfanyl]-5-phenyl-1-(2,2,2-trifluoroethyl)imidazole |
|---|---|
| PubChem CID | 60606986 |
| Molecular Formula | C16H13F5N4S |
| Molecular Weight | 388.37 g/mol |
| Exact Mass | 388.08 |
| IUPAC Name | 2-[[1-(difluoromethyl)imidazol-2-yl]methylsulfanyl]-5-phenyl-1-(2,2,2-trifluoroethyl)imidazole |
| SMILES | FC(F)n1ccnc1CSc1ncc(-c2ccccc2)n1CC(F)(F)F |
| InChI | InChI=1S/C16H13F5N4S/c17-14(18)24-7-6-22-13(24)9-26-15-23-8-12(11-4-2-1-3-5-11)25(15)10-16(19,20)21/h1-8,14H,9-10H2 |
| InChIKey | KPWJGRQOPTWDRY-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 35.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.37 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het_thio_5_A(8)', 'substructure': 'N/A'} |
|---|