C17H16F2N2O3 — CID 60609410
3,5-difluoro-4-[(3,4,5-trimethoxyphenyl)methylamino]benzonitrile (PubChem CID 60609410) has the molecular formula C17H16F2N2O3 and a molecular weight of 334.32 g/mol. Its IUPAC name is 3,5-difluoro-4-[(3,4,5-trimethoxyphenyl)methylamino]benzonitrile.
| Compound Name | 3,5-difluoro-4-[(3,4,5-trimethoxyphenyl)methylamino]benzonitrile |
|---|---|
| PubChem CID | 60609410 |
| Molecular Formula | C17H16F2N2O3 |
| Molecular Weight | 334.32 g/mol |
| Exact Mass | 334.11 |
| IUPAC Name | 3,5-difluoro-4-[(3,4,5-trimethoxyphenyl)methylamino]benzonitrile |
| SMILES | COc1cc(CNc2c(F)cc(C#N)cc2F)cc(OC)c1OC |
| InChI | InChI=1S/C17H16F2N2O3/c1-22-14-6-11(7-15(23-2)17(14)24-3)9-21-16-12(18)4-10(8-20)5-13(16)19/h4-7,21H,9H2,1-3H3 |
| InChIKey | AUKLZNSILJPEGR-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 63.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.32 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |