C15H14N4O6 — CID 60609870
N-(6-methoxy-3-pyridinyl)-N,2-dimethyl-3,5-dinitrobenzamide (PubChem CID 60609870) has the molecular formula C15H14N4O6 and a molecular weight of 346.30 g/mol. Its IUPAC name is N-(6-methoxy-3-pyridinyl)-N,2-dimethyl-3,5-dinitrobenzamide.
| Compound Name | N-(6-methoxy-3-pyridinyl)-N,2-dimethyl-3,5-dinitrobenzamide |
|---|---|
| PubChem CID | 60609870 |
| Molecular Formula | C15H14N4O6 |
| Molecular Weight | 346.30 g/mol |
| Exact Mass | 346.09 |
| IUPAC Name | N-(6-methoxy-3-pyridinyl)-N,2-dimethyl-3,5-dinitrobenzamide |
| SMILES | COc1ccc(N(C)C(=O)c2cc([N+](=O)[O-])cc([N+](=O)[O-])c2C)cn1 |
| InChI | InChI=1S/C15H14N4O6/c1-9-12(6-11(18(21)22)7-13(9)19(23)24)15(20)17(2)10-4-5-14(25-3)16-8-10/h4-8H,1-3H3 |
| InChIKey | VGJQZTAABBBCRR-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 128.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.30 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|