C8H11N3O3 — CID 60637145
2-(3,6-dioxo-1H-pyridazin-2-yl)-N,N-dimethylacetamide (PubChem CID 60637145) has the molecular formula C8H11N3O3 and a molecular weight of 197.19 g/mol. Its IUPAC name is 2-(3,6-dioxo-1H-pyridazin-2-yl)-N,N-dimethylacetamide.
| Compound Name | 2-(3,6-dioxo-1H-pyridazin-2-yl)-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 60637145 |
| Molecular Formula | C8H11N3O3 |
| Molecular Weight | 197.19 g/mol |
| Exact Mass | 197.08 |
| IUPAC Name | 2-(3,6-dioxo-1H-pyridazin-2-yl)-N,N-dimethylacetamide |
| SMILES | CN(C)C(=O)Cn1[nH]c(=O)ccc1=O |
| InChI | InChI=1S/C8H11N3O3/c1-10(2)8(14)5-11-7(13)4-3-6(12)9-11/h3-4H,5H2,1-2H3,(H,9,12) |
| InChIKey | VZJJBCXOEHFZED-UHFFFAOYSA-N |
| XLogP | -1.38 |
| TPSA | 75.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.19 |
| LogP ≤ 5 | -1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |