C12H17N3O5 — CID 60637313
ethyl 4-[[2-(3,6-dioxo-1H-pyridazin-2-yl)acetyl]amino]butanoate (PubChem CID 60637313) has the molecular formula C12H17N3O5 and a molecular weight of 283.28 g/mol. Its IUPAC name is ethyl 4-[[2-(3,6-dioxo-1H-pyridazin-2-yl)acetyl]amino]butanoate.
| Compound Name | ethyl 4-[[2-(3,6-dioxo-1H-pyridazin-2-yl)acetyl]amino]butanoate |
|---|---|
| PubChem CID | 60637313 |
| Molecular Formula | C12H17N3O5 |
| Molecular Weight | 283.28 g/mol |
| Exact Mass | 283.12 |
| IUPAC Name | ethyl 4-[[2-(3,6-dioxo-1H-pyridazin-2-yl)acetyl]amino]butanoate |
| SMILES | CCOC(=O)CCCNC(=O)Cn1[nH]c(=O)ccc1=O |
| InChI | InChI=1S/C12H17N3O5/c1-2-20-12(19)4-3-7-13-10(17)8-15-11(18)6-5-9(16)14-15/h5-6H,2-4,7-8H2,1H3,(H,13,17)(H,14,16) |
| InChIKey | YIINJGIFLYEKKQ-UHFFFAOYSA-N |
| XLogP | -1.00 |
| TPSA | 110.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.28 |
| LogP ≤ 5 | -1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|