C9H13N3O5 — CID 60638121
methyl 2-[[2-(2,5-dioxoimidazolidin-1-yl)acetyl]amino]propanoate (PubChem CID 60638121) has the molecular formula C9H13N3O5 and a molecular weight of 243.22 g/mol. Its IUPAC name is methyl 2-[[2-(2,5-dioxoimidazolidin-1-yl)acetyl]amino]propanoate.
| Compound Name | methyl 2-[[2-(2,5-dioxoimidazolidin-1-yl)acetyl]amino]propanoate |
|---|---|
| PubChem CID | 60638121 |
| Molecular Formula | C9H13N3O5 |
| Molecular Weight | 243.22 g/mol |
| Exact Mass | 243.09 |
| IUPAC Name | methyl 2-[[2-(2,5-dioxoimidazolidin-1-yl)acetyl]amino]propanoate |
| SMILES | COC(=O)C(C)NC(=O)CN1C(=O)CNC1=O |
| InChI | InChI=1S/C9H13N3O5/c1-5(8(15)17-2)11-6(13)4-12-7(14)3-10-9(12)16/h5H,3-4H2,1-2H3,(H,10,16)(H,11,13) |
| InChIKey | NUHYFGQDQRMVOR-UHFFFAOYSA-N |
| XLogP | -1.78 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.22 |
| LogP ≤ 5 | -1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|