C11H17N3O6 — CID 81077582
2-[[2-(2,5-dioxoimidazolidin-1-yl)acetyl]amino]-5-methoxypentanoic acid (PubChem CID 81077582) has the molecular formula C11H17N3O6 and a molecular weight of 287.27 g/mol. Its IUPAC name is 2-[[2-(2,5-dioxoimidazolidin-1-yl)acetyl]amino]-5-methoxypentanoic acid.
| Compound Name | 2-[[2-(2,5-dioxoimidazolidin-1-yl)acetyl]amino]-5-methoxypentanoic acid |
|---|---|
| PubChem CID | 81077582 |
| Molecular Formula | C11H17N3O6 |
| Molecular Weight | 287.27 g/mol |
| Exact Mass | 287.11 |
| IUPAC Name | 2-[[2-(2,5-dioxoimidazolidin-1-yl)acetyl]amino]-5-methoxypentanoic acid |
| SMILES | COCCCC(NC(=O)CN1C(=O)CNC1=O)C(=O)O |
| InChI | InChI=1S/C11H17N3O6/c1-20-4-2-3-7(10(17)18)13-8(15)6-14-9(16)5-12-11(14)19/h7H,2-6H2,1H3,(H,12,19)(H,13,15)(H,17,18) |
| InChIKey | TWMZATLWXRIEDC-UHFFFAOYSA-N |
| XLogP | -1.47 |
| TPSA | 125.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.27 |
| LogP ≤ 5 | -1.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|