C10H16N6OS — CID 60641960
2-[(E)-(4-methyl-2-morpholin-4-yl-1,3-thiazol-5-yl)methylideneamino]guanidine (PubChem CID 60641960) has the molecular formula C10H16N6OS and a molecular weight of 268.35 g/mol. Its IUPAC name is 2-[(E)-(4-methyl-2-morpholin-4-yl-1,3-thiazol-5-yl)methylideneamino]guanidine.
| Compound Name | 2-[(E)-(4-methyl-2-morpholin-4-yl-1,3-thiazol-5-yl)methylideneamino]guanidine |
|---|---|
| PubChem CID | 60641960 |
| Molecular Formula | C10H16N6OS |
| Molecular Weight | 268.35 g/mol |
| Exact Mass | 268.11 |
| IUPAC Name | 2-[(E)-(4-methyl-2-morpholin-4-yl-1,3-thiazol-5-yl)methylideneamino]guanidine |
| SMILES | Cc1nc(N2CCOCC2)sc1/C=N/N=C(N)N |
| InChI | InChI=1S/C10H16N6OS/c1-7-8(6-13-15-9(11)12)18-10(14-7)16-2-4-17-5-3-16/h6H,2-5H2,1H3,(H4,11,12,15)/b13-6+ |
| InChIKey | YHGKNCWEHKQRGG-AWNIVKPZSA-N |
| XLogP | -0.10 |
| TPSA | 102.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.35 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|