C18H20BrNO — CID 60643831
1-[2-(3-bromophenoxy)ethyl]-6-methyl-3,4-dihydro-2H-quinoline (PubChem CID 60643831) has the molecular formula C18H20BrNO and a molecular weight of 346.27 g/mol. Its IUPAC name is 1-[2-(3-bromophenoxy)ethyl]-6-methyl-3,4-dihydro-2H-quinoline.
| Compound Name | 1-[2-(3-bromophenoxy)ethyl]-6-methyl-3,4-dihydro-2H-quinoline |
|---|---|
| PubChem CID | 60643831 |
| Molecular Formula | C18H20BrNO |
| Molecular Weight | 346.27 g/mol |
| Exact Mass | 345.07 |
| IUPAC Name | 1-[2-(3-bromophenoxy)ethyl]-6-methyl-3,4-dihydro-2H-quinoline |
| SMILES | Cc1ccc2c(c1)CCCN2CCOc1cccc(Br)c1 |
| InChI | InChI=1S/C18H20BrNO/c1-14-7-8-18-15(12-14)4-3-9-20(18)10-11-21-17-6-2-5-16(19)13-17/h2,5-8,12-13H,3-4,9-11H2,1H3 |
| InChIKey | GGKVBVBTKXVPQH-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.27 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |