C12H13N3OS2 — CID 60658709
5-[4-(1,3-thiazol-2-yl)piperazin-1-yl]thiophene-2-carbaldehyde (PubChem CID 60658709) has the molecular formula C12H13N3OS2 and a molecular weight of 279.39 g/mol. Its IUPAC name is 5-[4-(1,3-thiazol-2-yl)piperazin-1-yl]thiophene-2-carbaldehyde.
| Compound Name | 5-[4-(1,3-thiazol-2-yl)piperazin-1-yl]thiophene-2-carbaldehyde |
|---|---|
| PubChem CID | 60658709 |
| Molecular Formula | C12H13N3OS2 |
| Molecular Weight | 279.39 g/mol |
| Exact Mass | 279.05 |
| IUPAC Name | 5-[4-(1,3-thiazol-2-yl)piperazin-1-yl]thiophene-2-carbaldehyde |
| SMILES | O=Cc1ccc(N2CCN(c3nccs3)CC2)s1 |
| InChI | InChI=1S/C12H13N3OS2/c16-9-10-1-2-11(18-10)14-4-6-15(7-5-14)12-13-3-8-17-12/h1-3,8-9H,4-7H2 |
| InChIKey | VRTDTTGRJXRUPG-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.39 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|