C16H32N4S — CID 60675444
4-[2-(dimethylamino)ethyl]-N-(2-methylcyclohexyl)piperazine-1-carbothioamide (PubChem CID 60675444) has the molecular formula C16H32N4S and a molecular weight of 312.53 g/mol. Its IUPAC name is 4-[2-(dimethylamino)ethyl]-N-(2-methylcyclohexyl)piperazine-1-carbothioamide.
| Compound Name | 4-[2-(dimethylamino)ethyl]-N-(2-methylcyclohexyl)piperazine-1-carbothioamide |
|---|---|
| PubChem CID | 60675444 |
| Molecular Formula | C16H32N4S |
| Molecular Weight | 312.53 g/mol |
| Exact Mass | 312.23 |
| IUPAC Name | 4-[2-(dimethylamino)ethyl]-N-(2-methylcyclohexyl)piperazine-1-carbothioamide |
| SMILES | CC1CCCCC1NC(=S)N1CCN(CCN(C)C)CC1 |
| InChI | InChI=1S/C16H32N4S/c1-14-6-4-5-7-15(14)17-16(21)20-12-10-19(11-13-20)9-8-18(2)3/h14-15H,4-13H2,1-3H3,(H,17,21) |
| InChIKey | AYSXZMYHPVYDNY-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 21.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.53 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|