C16H25N5S — CID 8669591
N-[(1R,2S)-2-methylcyclohexyl]-4-pyrimidin-2-ylpiperazine-1-carbothioamide (PubChem CID 8669591) has the molecular formula C16H25N5S and a molecular weight of 319.48 g/mol. Its IUPAC name is N-[(1R,2S)-2-methylcyclohexyl]-4-pyrimidin-2-ylpiperazine-1-carbothioamide.
| Compound Name | N-[(1R,2S)-2-methylcyclohexyl]-4-pyrimidin-2-ylpiperazine-1-carbothioamide |
|---|---|
| PubChem CID | 8669591 |
| Molecular Formula | C16H25N5S |
| Molecular Weight | 319.48 g/mol |
| Exact Mass | 319.18 |
| IUPAC Name | N-[(1R,2S)-2-methylcyclohexyl]-4-pyrimidin-2-ylpiperazine-1-carbothioamide |
| SMILES | C[C@H]1CCCC[C@H]1NC(=S)N1CCN(c2ncccn2)CC1 |
| InChI | InChI=1S/C16H25N5S/c1-13-5-2-3-6-14(13)19-16(22)21-11-9-20(10-12-21)15-17-7-4-8-18-15/h4,7-8,13-14H,2-3,5-6,9-12H2,1H3,(H,19,22)/t13-,14+/m0/s1 |
| InChIKey | LNGXIWAICOLBJF-UONOGXRCSA-N |
| XLogP | 2.05 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.48 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|