C17H18BrNO2 — CID 60694319
N-[2-(3-bromophenoxy)ethyl]-3,4-dihydro-2H-chromen-4-amine (PubChem CID 60694319) has the molecular formula C17H18BrNO2 and a molecular weight of 348.24 g/mol. Its IUPAC name is N-[2-(3-bromophenoxy)ethyl]-3,4-dihydro-2H-chromen-4-amine.
| Compound Name | N-[2-(3-bromophenoxy)ethyl]-3,4-dihydro-2H-chromen-4-amine |
|---|---|
| PubChem CID | 60694319 |
| Molecular Formula | C17H18BrNO2 |
| Molecular Weight | 348.24 g/mol |
| Exact Mass | 347.05 |
| IUPAC Name | N-[2-(3-bromophenoxy)ethyl]-3,4-dihydro-2H-chromen-4-amine |
| SMILES | Brc1cccc(OCCNC2CCOc3ccccc32)c1 |
| InChI | InChI=1S/C17H18BrNO2/c18-13-4-3-5-14(12-13)20-11-9-19-16-8-10-21-17-7-2-1-6-15(16)17/h1-7,12,16,19H,8-11H2 |
| InChIKey | AVWYYDPSLZZGMM-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.24 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|