C30H24ClN3O6S — CID 6070732
[4-[(Z)-[[2-[(4-chlorophenyl)sulfonylamino]benzoyl]hydrazinylidene]methyl]-2-methoxyphenyl] (E)-3-phenylprop-2-enoate (PubChem CID 6070732) has the molecular formula C30H24ClN3O6S and a molecular weight of 590.06 g/mol. Its IUPAC name is [4-[(Z)-[[2-[(4-chlorophenyl)sulfonylamino]benzoyl]hydrazinylidene]methyl]-2-methoxyphenyl] (E)-3-phenylprop-2-enoate.
| Compound Name | [4-[(Z)-[[2-[(4-chlorophenyl)sulfonylamino]benzoyl]hydrazinylidene]methyl]-2-methoxyphenyl] (E)-3-phenylprop-2-enoate |
|---|---|
| PubChem CID | 6070732 |
| Molecular Formula | C30H24ClN3O6S |
| Molecular Weight | 590.06 g/mol |
| Exact Mass | 589.11 |
| IUPAC Name | [4-[(Z)-[[2-[(4-chlorophenyl)sulfonylamino]benzoyl]hydrazinylidene]methyl]-2-methoxyphenyl] (E)-3-phenylprop-2-enoate |
| SMILES | COc1cc(/C=N\NC(=O)c2ccccc2NS(=O)(=O)c2ccc(Cl)cc2)ccc1OC(=O)/C=C/c1ccccc1 |
| InChI | InChI=1S/C30H24ClN3O6S/c1-39-28-19-22(11-17-27(28)40-29(35)18-12-21-7-3-2-4-8-21)20-32-33-30(36)25-9-5-6-10-26(25)34-41(37,38)24-15-13-23(31)14-16-24/h2-20,34H,1H3,(H,33,36)/b18-12+,32-20- |
| InChIKey | DHFVNTMSLIBZNI-UMQADKONSA-N |
| XLogP | 5.53 |
| TPSA | 123.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.06 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|