C9H12N4O — CID 60740516
2-cyclopent-2-en-1-yl-N-(1H-1,2,4-triazol-5-yl)acetamide (PubChem CID 60740516) has the molecular formula C9H12N4O and a molecular weight of 192.22 g/mol. Its IUPAC name is 2-cyclopent-2-en-1-yl-N-(1H-1,2,4-triazol-5-yl)acetamide.
| Compound Name | 2-cyclopent-2-en-1-yl-N-(1H-1,2,4-triazol-5-yl)acetamide |
|---|---|
| PubChem CID | 60740516 |
| Molecular Formula | C9H12N4O |
| Molecular Weight | 192.22 g/mol |
| Exact Mass | 192.10 |
| IUPAC Name | 2-cyclopent-2-en-1-yl-N-(1H-1,2,4-triazol-5-yl)acetamide |
| SMILES | O=C(CC1C=CCC1)Nc1ncn[nH]1 |
| InChI | InChI=1S/C9H12N4O/c14-8(5-7-3-1-2-4-7)12-9-10-6-11-13-9/h1,3,6-7H,2,4-5H2,(H2,10,11,12,13,14) |
| InChIKey | IMIMULOUVAUEAF-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.22 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|