C26H28Cl4N2O2 — CID 6074176
(E)-3-(3,4-dichlorophenyl)-N-[8-[[(E)-3-(3,4-dichlorophenyl)prop-2-enoyl]amino]octyl]prop-2-enamide (PubChem CID 6074176) has the molecular formula C26H28Cl4N2O2 and a molecular weight of 542.33 g/mol. Its IUPAC name is (E)-3-(3,4-dichlorophenyl)-N-[8-[[(E)-3-(3,4-dichlorophenyl)prop-2-enoyl]amino]octyl]prop-2-enamide.
| Compound Name | (E)-3-(3,4-dichlorophenyl)-N-[8-[[(E)-3-(3,4-dichlorophenyl)prop-2-enoyl]amino]octyl]prop-2-enamide |
|---|---|
| PubChem CID | 6074176 |
| Molecular Formula | C26H28Cl4N2O2 |
| Molecular Weight | 542.33 g/mol |
| Exact Mass | 540.09 |
| IUPAC Name | (E)-3-(3,4-dichlorophenyl)-N-[8-[[(E)-3-(3,4-dichlorophenyl)prop-2-enoyl]amino]octyl]prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc(Cl)c(Cl)c1)NCCCCCCCCNC(=O)/C=C/c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C26H28Cl4N2O2/c27-21-11-7-19(17-23(21)29)9-13-25(33)31-15-5-3-1-2-4-6-16-32-26(34)14-10-20-8-12-22(28)24(30)18-20/h7-14,17-18H,1-6,15-16H2,(H,31,33)(H,32,34)/b13-9+,14-10+ |
| InChIKey | MAGUVILCMULXQS-UTLPMFLDSA-N |
| XLogP | 7.60 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.33 |
| LogP ≤ 5 | 7.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|