C10H10N2O5S — CID 607768
2-(4-hydroxy-3-nitrophenyl)-1,3-thiazolidine-5-carboxylic acid (PubChem CID 607768) has the molecular formula C10H10N2O5S and a molecular weight of 270.27 g/mol. Its IUPAC name is 2-(4-hydroxy-3-nitrophenyl)-1,3-thiazolidine-5-carboxylic acid.
| Compound Name | 2-(4-hydroxy-3-nitrophenyl)-1,3-thiazolidine-5-carboxylic acid |
|---|---|
| PubChem CID | 607768 |
| Molecular Formula | C10H10N2O5S |
| Molecular Weight | 270.27 g/mol |
| Exact Mass | 270.03 |
| IUPAC Name | 2-(4-hydroxy-3-nitrophenyl)-1,3-thiazolidine-5-carboxylic acid |
| SMILES | O=C(O)C1CNC(c2ccc(O)c([N+](=O)[O-])c2)S1 |
| InChI | InChI=1S/C10H10N2O5S/c13-7-2-1-5(3-6(7)12(16)17)9-11-4-8(18-9)10(14)15/h1-3,8-9,11,13H,4H2,(H,14,15) |
| InChIKey | CEEHWPZUKGACGX-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 112.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.27 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|