C13H16BrClN2O2S — CID 60779869
5-bromo-2-chloro-N-[2-(cyclohexen-1-yl)ethyl]pyridine-3-sulfonamide (PubChem CID 60779869) has the molecular formula C13H16BrClN2O2S and a molecular weight of 379.71 g/mol. Its IUPAC name is 5-bromo-2-chloro-N-[2-(cyclohexen-1-yl)ethyl]pyridine-3-sulfonamide.
| Compound Name | 5-bromo-2-chloro-N-[2-(cyclohexen-1-yl)ethyl]pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 60779869 |
| Molecular Formula | C13H16BrClN2O2S |
| Molecular Weight | 379.71 g/mol |
| Exact Mass | 377.98 |
| IUPAC Name | 5-bromo-2-chloro-N-[2-(cyclohexen-1-yl)ethyl]pyridine-3-sulfonamide |
| SMILES | O=S(=O)(NCCC1=CCCCC1)c1cc(Br)cnc1Cl |
| InChI | InChI=1S/C13H16BrClN2O2S/c14-11-8-12(13(15)16-9-11)20(18,19)17-7-6-10-4-2-1-3-5-10/h4,8-9,17H,1-3,5-7H2 |
| InChIKey | HAVRCAPZOGFNNQ-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.71 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|