C14H11N3O4 — CID 60804135
N-[4-(3-hydroxyprop-1-ynyl)phenyl]-2,4-dioxo-1H-pyrimidine-5-carboxamide (PubChem CID 60804135) has the molecular formula C14H11N3O4 and a molecular weight of 285.26 g/mol. Its IUPAC name is N-[4-(3-hydroxyprop-1-ynyl)phenyl]-2,4-dioxo-1H-pyrimidine-5-carboxamide.
| Compound Name | N-[4-(3-hydroxyprop-1-ynyl)phenyl]-2,4-dioxo-1H-pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 60804135 |
| Molecular Formula | C14H11N3O4 |
| Molecular Weight | 285.26 g/mol |
| Exact Mass | 285.07 |
| IUPAC Name | N-[4-(3-hydroxyprop-1-ynyl)phenyl]-2,4-dioxo-1H-pyrimidine-5-carboxamide |
| SMILES | O=C(Nc1ccc(C#CCO)cc1)c1c[nH]c(=O)[nH]c1=O |
| InChI | InChI=1S/C14H11N3O4/c18-7-1-2-9-3-5-10(6-4-9)16-12(19)11-8-15-14(21)17-13(11)20/h3-6,8,18H,7H2,(H,16,19)(H2,15,17,20,21) |
| InChIKey | XBKFECHGILOXJT-UHFFFAOYSA-N |
| XLogP | -0.34 |
| TPSA | 115.05 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.26 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|