About 4-(2,2,2-trifluoroethylamino)cyclohexane-1-carboxylic acid
4-(2,2,2-trifluoroethylamino)cyclohexane-1-carboxylic acid (PubChem CID 60809885) has the molecular formula C9H14F3NO2
and a molecular weight of 225.21 g/mol. Its IUPAC name is 4-(2,2,2-trifluoroethylamino)cyclohexane-1-carboxylic acid.
Analyze 4-(2,2,2-trifluoroethylamino)cyclohexane-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2,2,2-trifluoroethylamino)cyclohexane-1-carboxylic acid?
The IUPAC name of 4-(2,2,2-trifluoroethylamino)cyclohexane-1-carboxylic acid (CID 60809885) is 4-(2,2,2-trifluoroethylamino)cyclohexane-1-carboxylic acid.
What is the SMILES notation for 4-(2,2,2-trifluoroethylamino)cyclohexane-1-carboxylic acid?
The canonical SMILES for 4-(2,2,2-trifluoroethylamino)cyclohexane-1-carboxylic acid is O=C(O)C1CCC(NCC(F)(F)F)CC1.
What is the InChIKey of 4-(2,2,2-trifluoroethylamino)cyclohexane-1-carboxylic acid?
The InChIKey is KLGRRLCGCPZXRQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14F3NO2/c10-9(11,12)5-13-7-3-1-6(2-4-7)8(14)15/h6-7,13H,1-5H2,(H,14,15).
What are the key properties of 4-(2,2,2-trifluoroethylamino)cyclohexane-1-carboxylic acid?
4-(2,2,2-trifluoroethylamino)cyclohexane-1-carboxylic acid has a molecular weight of 225.21 g/mol, XLogP of 1.78, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2,2,2-trifluoroethylamino)cyclohexane-1-carboxylic acid is sourced from PubChem (CID 60809885), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).