C25H21ClN2O4S — CID 6082156
2-(N-(1,1-dioxo-1,2-benzothiazol-3-yl)-4-methylanilino)ethyl (E)-3-(3-chlorophenyl)prop-2-enoate (PubChem CID 6082156) has the molecular formula C25H21ClN2O4S and a molecular weight of 480.97 g/mol. Its IUPAC name is 2-(N-(1,1-dioxo-1,2-benzothiazol-3-yl)-4-methylanilino)ethyl (E)-3-(3-chlorophenyl)prop-2-enoate.
| Compound Name | 2-(N-(1,1-dioxo-1,2-benzothiazol-3-yl)-4-methylanilino)ethyl (E)-3-(3-chlorophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 6082156 |
| Molecular Formula | C25H21ClN2O4S |
| Molecular Weight | 480.97 g/mol |
| Exact Mass | 480.09 |
| IUPAC Name | 2-(N-(1,1-dioxo-1,2-benzothiazol-3-yl)-4-methylanilino)ethyl (E)-3-(3-chlorophenyl)prop-2-enoate |
| SMILES | Cc1ccc(N(CCOC(=O)/C=C/c2cccc(Cl)c2)C2=NS(=O)(=O)c3ccccc32)cc1 |
| InChI | InChI=1S/C25H21ClN2O4S/c1-18-9-12-21(13-10-18)28(25-22-7-2-3-8-23(22)33(30,31)27-25)15-16-32-24(29)14-11-19-5-4-6-20(26)17-19/h2-14,17H,15-16H2,1H3/b14-11+ |
| InChIKey | FIMYNCICMWNEHU-SDNWHVSQSA-N |
| XLogP | 4.86 |
| TPSA | 76.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.97 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|