C24H18Cl2N2O4S — CID 5243396
2-(2-chloro-N-(1,1-dioxo-1,2-benzothiazol-3-yl)anilino)ethyl 3-(3-chlorophenyl)prop-2-enoate (PubChem CID 5243396) has the molecular formula C24H18Cl2N2O4S and a molecular weight of 501.39 g/mol. Its IUPAC name is 2-(2-chloro-N-(1,1-dioxo-1,2-benzothiazol-3-yl)anilino)ethyl 3-(3-chlorophenyl)prop-2-enoate.
| Compound Name | 2-(2-chloro-N-(1,1-dioxo-1,2-benzothiazol-3-yl)anilino)ethyl 3-(3-chlorophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 5243396 |
| Molecular Formula | C24H18Cl2N2O4S |
| Molecular Weight | 501.39 g/mol |
| Exact Mass | 500.04 |
| IUPAC Name | 2-(2-chloro-N-(1,1-dioxo-1,2-benzothiazol-3-yl)anilino)ethyl 3-(3-chlorophenyl)prop-2-enoate |
| SMILES | O=C(C=Cc1cccc(Cl)c1)OCCN(C1=NS(=O)(=O)c2ccccc21)c1ccccc1Cl |
| InChI | InChI=1S/C24H18Cl2N2O4S/c25-18-7-5-6-17(16-18)12-13-23(29)32-15-14-28(21-10-3-2-9-20(21)26)24-19-8-1-4-11-22(19)33(30,31)27-24/h1-13,16H,14-15H2 |
| InChIKey | QNYFZXHZCINOEE-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 76.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.39 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|