C13H13Cl2NO3S — CID 60824255
3-(3,5-dichloro-4-pyrrolidin-1-ylsulfonylphenyl)prop-2-yn-1-ol (PubChem CID 60824255) has the molecular formula C13H13Cl2NO3S and a molecular weight of 334.22 g/mol. Its IUPAC name is 3-(3,5-dichloro-4-pyrrolidin-1-ylsulfonylphenyl)prop-2-yn-1-ol.
| Compound Name | 3-(3,5-dichloro-4-pyrrolidin-1-ylsulfonylphenyl)prop-2-yn-1-ol |
|---|---|
| PubChem CID | 60824255 |
| Molecular Formula | C13H13Cl2NO3S |
| Molecular Weight | 334.22 g/mol |
| Exact Mass | 333.00 |
| IUPAC Name | 3-(3,5-dichloro-4-pyrrolidin-1-ylsulfonylphenyl)prop-2-yn-1-ol |
| SMILES | O=S(=O)(c1c(Cl)cc(C#CCO)cc1Cl)N1CCCC1 |
| InChI | InChI=1S/C13H13Cl2NO3S/c14-11-8-10(4-3-7-17)9-12(15)13(11)20(18,19)16-5-1-2-6-16/h8-9,17H,1-2,5-7H2 |
| InChIKey | JJEUAYUTCFLNCS-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.22 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|