C12H12Cl2N2O4S — CID 60824762
2-[[2,6-dichloro-4-(3-hydroxyprop-1-ynyl)phenyl]sulfonyl-methylamino]acetamide (PubChem CID 60824762) has the molecular formula C12H12Cl2N2O4S and a molecular weight of 351.21 g/mol. Its IUPAC name is 2-[[2,6-dichloro-4-(3-hydroxyprop-1-ynyl)phenyl]sulfonyl-methylamino]acetamide.
| Compound Name | 2-[[2,6-dichloro-4-(3-hydroxyprop-1-ynyl)phenyl]sulfonyl-methylamino]acetamide |
|---|---|
| PubChem CID | 60824762 |
| Molecular Formula | C12H12Cl2N2O4S |
| Molecular Weight | 351.21 g/mol |
| Exact Mass | 349.99 |
| IUPAC Name | 2-[[2,6-dichloro-4-(3-hydroxyprop-1-ynyl)phenyl]sulfonyl-methylamino]acetamide |
| SMILES | CN(CC(N)=O)S(=O)(=O)c1c(Cl)cc(C#CCO)cc1Cl |
| InChI | InChI=1S/C12H12Cl2N2O4S/c1-16(7-11(15)18)21(19,20)12-9(13)5-8(3-2-4-17)6-10(12)14/h5-6,17H,4,7H2,1H3,(H2,15,18) |
| InChIKey | QHPAGWXIGIBPAE-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 100.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.21 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|